N-(7-chloroquinolin-4-yl)-N,N-diethyl-hexane-1,5-diamine
Modify Date: 2024-02-06 20:44:32
N-(7-chloroquinolin-4-yl)-N,N-diethyl-hexane-1,5-diamine structure
|
Common Name | N-(7-chloroquinolin-4-yl)-N,N-diethyl-hexane-1,5-diamine | ||
|---|---|---|---|---|
| CAS Number | 5430-89-7 | Molecular Weight | 333.89900 | |
| Density | 1.097g/cm3 | Boiling Point | 472.5ºC at 760 mmHg | |
| Molecular Formula | C19H28ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.6ºC | |
| Name | N5,N5-Diaethyl-N1-(7-chlor-[4]chinolyl)-2-(4-chlor-phenyl)-pentandiyldiamin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.097g/cm3 |
|---|---|
| Boiling Point | 472.5ºC at 760 mmHg |
| Molecular Formula | C19H28ClN3 |
| Molecular Weight | 333.89900 |
| Flash Point | 239.6ºC |
| Exact Mass | 333.19700 |
| PSA | 28.16000 |
| LogP | 5.27370 |
| Index of Refraction | 1.585 |
| HS Code | 2933499090 |
|---|
|
~%
N-(7-chloroquin... CAS#:5430-89-7 |
| Literature: Drake et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1208,1210 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4-chlorophenyl)-n1-(7-chloroquinolin-4-yl)-n5,n5-diethylpentane-1,5-diamine |
| N5,N5-diethyl-N1-(7-chloro-[4]quinolyl)-2-(4-chloro-phenyl)-pentanediyldiamine |
| N5,N5-diethyl-N1-(7-chloro-[4]quinolyl)-1-methyl-pentanediyldiamine |
| N5,N5-Diaethyl-N1-(7-chlor-[4]chinolyl)-1-methyl-pentandiyldiamin |