N-[(4-diethylaminophenyl)methyl]-2-methyl-quinolin-4-amine
Modify Date: 2025-10-30 20:31:04
![N-[(4-diethylaminophenyl)methyl]-2-methyl-quinolin-4-amine Structure](https://image.chemsrc.com/caspic/313/5430-95-5.png)
N-[(4-diethylaminophenyl)methyl]-2-methyl-quinolin-4-amine structure
|
Common Name | N-[(4-diethylaminophenyl)methyl]-2-methyl-quinolin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 5430-95-5 | Molecular Weight | 319.44300 | |
| Density | 1.123g/cm3 | Boiling Point | 486.5ºC at 760 mmHg | |
| Molecular Formula | C21H25N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.1ºC | |
| Name | p-Cyclohexylphenyl-bernsteinsaeure |
|---|---|
| Synonym | More Synonyms |
| Density | 1.123g/cm3 |
|---|---|
| Boiling Point | 486.5ºC at 760 mmHg |
| Molecular Formula | C21H25N3 |
| Molecular Weight | 319.44300 |
| Flash Point | 248.1ºC |
| Exact Mass | 319.20500 |
| PSA | 28.16000 |
| LogP | 5.07450 |
| Index of Refraction | 1.658 |
| InChIKey | BJOMRYYBSOHJLR-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(CNc2cc(C)nc3ccccc23)cc1 |
| HS Code | 2933499090 |
|---|
|
~%
N-[(4-diethylam... CAS#:5430-95-5 |
| Literature: Ramsey et al. Journal of the American Chemical Society, 1947 , vol. 69, p. 67 |
|
~%
N-[(4-diethylam... CAS#:5430-95-5 |
| Literature: Ramsey et al. Journal of the American Chemical Society, 1947 , vol. 69, p. 67 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (4-diethylamino-benzyl)-(2-methyl-[4]quinolyl)-amine |
| dimethyl 2-(4-cyclohexylphenyl)succinate |
| (4-Cylohexylphenyl)bernsteinsaeure |
| (4-Diaethylamino-benzyl)-(2-methyl-[4]chinolyl)-amin |
| 4-Cyclohexylphenylbernsteinsaeure |
| Butanedioic acid,(4-cyclohexylphenyl) |