CYCLO(L-ALA-L-HIS) structure
|
Common Name | CYCLO(L-ALA-L-HIS) | ||
|---|---|---|---|---|
| CAS Number | 54300-25-3 | Molecular Weight | 208.21700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Cyclo(-Ala-His) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H12N4O2 |
|---|---|
| Molecular Weight | 208.21700 |
| Exact Mass | 208.09600 |
| PSA | 86.88000 |
| InChIKey | KWWFDFUTSPWSFY-FSPLSTOPSA-N |
| SMILES | CC1NC(=O)C(Cc2cnc[nH]2)NC1=O |
| Storage condition | 2-8°C |
| HS Code | 2933990090 |
|---|
|
~%
CYCLO(L-ALA-L-HIS) CAS#:54300-25-3 |
| Literature: Arena, Giuseppe; Impellizzeri, Giuseppe; Maccarrone, Giuseppe; Pappalardo, Giuseppe; Sciotto, Domenico; Rizzarelli, Enrico Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1992 , # 3 p. 371 - 376 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| CYCLO(L-ALA-L-HIS) |
| cyclo-Ala-His |
| cyclo-(L-alanyl-L-histidyl) |