N,N-diethyl-N-(6-phenoxyquinolin-4-yl)pentane-1,4-diamine
Modify Date: 2025-08-22 13:36:56
N,N-diethyl-N-(6-phenoxyquinolin-4-yl)pentane-1,4-diamine structure
|
Common Name | N,N-diethyl-N-(6-phenoxyquinolin-4-yl)pentane-1,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 5431-04-9 | Molecular Weight | 377.52200 | |
| Density | 1.089g/cm3 | Boiling Point | 532.1ºC at 760 mmHg | |
| Molecular Formula | C24H31N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.6ºC | |
| Name | N1,N1-diethyl-N4-(6-phenoxyquinolin-4-yl)pentane-1,4-diamine |
|---|
| Density | 1.089g/cm3 |
|---|---|
| Boiling Point | 532.1ºC at 760 mmHg |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.52200 |
| Flash Point | 275.6ºC |
| Exact Mass | 377.24700 |
| PSA | 37.39000 |
| LogP | 6.02250 |
| Index of Refraction | 1.602 |
| InChIKey | YZERXGOIZQSVOM-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCC(C)Nc1ccnc2ccc(Oc3ccccc3)cc12 |
| HS Code | 2933499090 |
|---|
|
~%
N,N-diethyl-N-(... CAS#:5431-04-9 |
| Literature: Drake et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1208,1210 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |