N-benzo[1,3]dioxol-5-yl-2-(cyclooctylcarbamoylmethylsulfanyl)benzamide structure
|
Common Name | N-benzo[1,3]dioxol-5-yl-2-(cyclooctylcarbamoylmethylsulfanyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 5431-10-7 | Molecular Weight | 480.98200 | |
| Density | 1.028g/cm3 | Boiling Point | 531.5ºC at 760 mmHg | |
| Molecular Formula | C25H44Cl3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.2ºC | |
| Name | N-(1,3-benzodioxol-5-yl)-2-[2-(cyclooctylamino)-2-oxoethyl]sulfanylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.028g/cm3 |
|---|---|
| Boiling Point | 531.5ºC at 760 mmHg |
| Molecular Formula | C25H44Cl3NO |
| Molecular Weight | 480.98200 |
| Flash Point | 275.2ºC |
| Exact Mass | 479.24900 |
| PSA | 23.47000 |
| LogP | 9.16020 |
| Index of Refraction | 1.512 |
| InChIKey | BUDWWMGZLZMSQB-UHFFFAOYSA-N |
| SMILES | O=C(CSc1ccccc1C(=O)Nc1ccc2c(c1)OCO2)NC1CCCCCCC1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| t0518-8579 |