4-Quinolinamine,7-chloro-N-(4-chlorophenyl)- structure
|
Common Name | 4-Quinolinamine,7-chloro-N-(4-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 5431-39-0 | Molecular Weight | 289.15900 | |
| Density | 1.398g/cm3 | Boiling Point | 431.8ºC at 760 mmHg | |
| Molecular Formula | C15H10Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.9ºC | |
| Name | 7-chloro-N-(4-chlorophenyl)quinolin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.398g/cm3 |
|---|---|
| Boiling Point | 431.8ºC at 760 mmHg |
| Molecular Formula | C15H10Cl2N2 |
| Molecular Weight | 289.15900 |
| Flash Point | 214.9ºC |
| Exact Mass | 288.02200 |
| PSA | 24.92000 |
| LogP | 5.35820 |
| Index of Refraction | 1.716 |
| InChIKey | INDMTPBIQLWRLM-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Nc2ccnc3cc(Cl)ccc23)cc1 |
| HS Code | 2933499090 |
|---|
|
~94%
4-Quinolinamine... CAS#:5431-39-0 |
| Literature: Motiwala, Hashim F.; Kumar, Raj; Chakraborti, Asit K. Australian Journal of Chemistry, 2007 , vol. 60, # 5 p. 369 - 374 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (7-Chlor-[4]chinolyl)-(4-chlor-phenyl)-amin |
| 4-quinolinamine,7-chloro-n-(4-chlorophenyl) |
| (7-chloro-[4]quinolyl)-(4-chloro-phenyl)-amine |