4-[2-(4,6-dimethylquinolin-2-yl)ethenyl]-N,N-diethyl-aniline structure
|
Common Name | 4-[2-(4,6-dimethylquinolin-2-yl)ethenyl]-N,N-diethyl-aniline | ||
|---|---|---|---|---|
| CAS Number | 5431-69-6 | Molecular Weight | 330.46600 | |
| Density | 1.088g/cm3 | Boiling Point | 500ºC at 760 mmHg | |
| Molecular Formula | C23H26N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.2ºC | |
| Name | (Z)-4-(2-(4,6-dimethylquinolin-2-yl)vinyl)-N,N-diethylaniline |
|---|
| Density | 1.088g/cm3 |
|---|---|
| Boiling Point | 500ºC at 760 mmHg |
| Molecular Formula | C23H26N2 |
| Molecular Weight | 330.46600 |
| Flash Point | 256.2ºC |
| Exact Mass | 330.21000 |
| PSA | 16.13000 |
| LogP | 5.86820 |
| Index of Refraction | 1.665 |
| InChIKey | GLWRYJUYFWCCNB-FLIBITNWSA-N |
| SMILES | CCN(CC)c1ccc(C=Cc2cc(C)c3cc(C)ccc3n2)cc1 |
| HS Code | 2933499090 |
|---|
|
~%
4-[2-(4,6-dimet... CAS#:5431-69-6 |
| Literature: Tipson Journal of the American Chemical Society, 1945 , vol. 67, p. 507,508, 510 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |