N-(benzylideneamino)-4-[3-[(benzylideneamino)carbamoyl]propylsulfanyl]butanamide structure
|
Common Name | N-(benzylideneamino)-4-[3-[(benzylideneamino)carbamoyl]propylsulfanyl]butanamide | ||
|---|---|---|---|---|
| CAS Number | 5432-20-2 | Molecular Weight | 410.53200 | |
| Density | 1.148g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H26N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(E)-benzylideneamino]-4-[4-[(2Z)-2-benzylidenehydrazinyl]-4-oxobutyl]sulfanylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.148g/cm3 |
|---|---|
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.53200 |
| Exact Mass | 410.17800 |
| PSA | 108.22000 |
| LogP | 4.36240 |
| Index of Refraction | 1.59 |
| InChIKey | CDWAGJPFFCBBKY-QFFDILLMSA-N |
| SMILES | O=C(CCCSCCCC(=O)NN=Cc1ccccc1)NN=Cc1ccccc1 |
| HS Code | 2930909090 |
|---|
|
~%
N-(benzylidenea... CAS#:5432-20-2 |
| Literature: Zimmer; Shaheen Journal of Organic Chemistry, 1959 , vol. 24, p. 1140 |
|
~%
N-(benzylidenea... CAS#:5432-20-2 |
| Literature: Zimmer; Shaheen Journal of Organic Chemistry, 1959 , vol. 24, p. 1140 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4,4'-Sulfandiyl-di-buttersaeure-bis-benzylidenhydrazid |
| 4,4'-sulfanediyl-di-butyric acid bis-benzylidenehydrazide |