5-Thiazolidineaceticacid, a-[(4-chlorophenyl)thio]-4-oxo-3-(phenylmethyl)-2-thioxo-,methyl ester structure
|
Common Name | 5-Thiazolidineaceticacid, a-[(4-chlorophenyl)thio]-4-oxo-3-(phenylmethyl)-2-thioxo-,methyl ester | ||
|---|---|---|---|---|
| CAS Number | 54326-52-2 | Molecular Weight | 437.98300 | |
| Density | 1.47g/cm3 | Boiling Point | 568.9ºC at 760 mmHg | |
| Molecular Formula | C19H16ClNO3S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.9ºC | |
| Name | methyl 2-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)-2-(4-chlorophenyl)sulfanylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 568.9ºC at 760 mmHg |
| Molecular Formula | C19H16ClNO3S3 |
| Molecular Weight | 437.98300 |
| Flash Point | 297.9ºC |
| Exact Mass | 436.99800 |
| PSA | 129.30000 |
| LogP | 4.34070 |
| Index of Refraction | 1.705 |
| InChIKey | SCFYJGSMZBGPRO-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Sc1ccc(Cl)cc1)C1SC(=S)N(Cc2ccccc2)C1=O |
|
~%
5-Thiazolidinea... CAS#:54326-52-2 |
| Literature: Nagase Chemical and Pharmaceutical Bulletin, 1974 , vol. 22, # 1 p. 42 - 49 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (3-benzyl-4-oxo-2-thioxo-thiazolidin-5-yl)-(4-chloro-phenylsulfanyl)-acetic acid methyl ester |