2-carbamoylsulfanyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]acetamide structure
|
Common Name | 2-carbamoylsulfanyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 5433-33-0 | Molecular Weight | 366.41500 | |
| Density | 1.551g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H14N4O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-(2-oxo-2-{[4-(pyridin-2-ylsulfamoyl)phenyl]amino}ethyl) carbamothioate |
|---|
| Density | 1.551g/cm3 |
|---|---|
| Molecular Formula | C14H14N4O4S2 |
| Molecular Weight | 366.41500 |
| Exact Mass | 366.04600 |
| PSA | 164.93000 |
| LogP | 3.55990 |
| Index of Refraction | 1.698 |
| InChIKey | CDYGABFPNWILRB-UHFFFAOYSA-N |
| SMILES | NC(=O)SCC(=O)Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1 |
| HS Code | 2935009090 |
|---|
|
~%
2-carbamoylsulf... CAS#:5433-33-0 |
| Literature: Weiss Journal of the American Chemical Society, 1947 , vol. 69, p. 2682 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|