10-Undecenoic acid,1,3-benzodioxol-5-ylmethyl ester structure
|
Common Name | 10-Undecenoic acid,1,3-benzodioxol-5-ylmethyl ester | ||
|---|---|---|---|---|
| CAS Number | 5434-15-1 | Molecular Weight | 318.40700 | |
| Density | 1.071g/cm3 | Boiling Point | 412.3ºC at 760 mmHg | |
| Molecular Formula | C19H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178ºC | |
| Name | 1,3-benzodioxol-5-ylmethyl undec-10-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.071g/cm3 |
|---|---|
| Boiling Point | 412.3ºC at 760 mmHg |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.40700 |
| Flash Point | 178ºC |
| Exact Mass | 318.18300 |
| PSA | 44.76000 |
| LogP | 4.76530 |
| Index of Refraction | 1.516 |
| InChIKey | CBEMDLAFWIVOMT-UHFFFAOYSA-N |
| SMILES | C=CCCCCCCCCC(=O)OCc1ccc2c(c1)OCO2 |
| HS Code | 2932999099 |
|---|
|
~%
10-Undecenoic a... CAS#:5434-15-1 |
| Literature: Barthel; Gertler U.S. Dep. Agric. ARS, 33-27 <1956> 1, 3 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Undec-10-ensaeure-piperonylester |
| undec-10-enoic acid piperonyl ester |