1-Propanone,3-(4-chlorophenyl)-1-phenyl-, oxime structure
|
Common Name | 1-Propanone,3-(4-chlorophenyl)-1-phenyl-, oxime | ||
|---|---|---|---|---|
| CAS Number | 5434-79-7 | Molecular Weight | 259.73100 | |
| Density | 1.13g/cm3 | Boiling Point | 417.1ºC at 760 mmHg | |
| Molecular Formula | C15H14ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.1ºC | |
| Name | (NZ)-N-[3-(4-chlorophenyl)-1-phenylpropylidene]hydroxylamine |
|---|
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 417.1ºC at 760 mmHg |
| Molecular Formula | C15H14ClNO |
| Molecular Weight | 259.73100 |
| Flash Point | 206.1ºC |
| Exact Mass | 259.07600 |
| PSA | 32.59000 |
| LogP | 4.15110 |
| Index of Refraction | 1.571 |
| InChIKey | HDYSFNMPMKUZHB-BMRADRMJSA-N |
| SMILES | ON=C(CCc1ccc(Cl)cc1)c1ccccc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |