Cyclopentanecarboxamide,N-acetyl-1-(acetyloxy) structure
|
Common Name | Cyclopentanecarboxamide,N-acetyl-1-(acetyloxy) | ||
|---|---|---|---|---|
| CAS Number | 5434-93-5 | Molecular Weight | 213.23000 | |
| Density | 1.17g/cm3 | Boiling Point | 343.3ºC at 760 mmHg | |
| Molecular Formula | C10H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.4ºC | |
| Name | [1-(acetylcarbamoyl)cyclopentyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 343.3ºC at 760 mmHg |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23000 |
| Flash Point | 161.4ºC |
| Exact Mass | 213.10000 |
| PSA | 72.47000 |
| LogP | 0.91590 |
| Index of Refraction | 1.486 |
| InChIKey | RYGXHUMGUVCLRV-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(=O)C1(OC(C)=O)CCCC1 |
|
~%
Cyclopentanecar... CAS#:5434-93-5 |
| Literature: McElvain; Starn Journal of the American Chemical Society, 1955 , vol. 77, p. 4571,4577 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Acetoxy-cyclopentancarbonsaeure-acetylamid |