2,6,6,10-tetramethyl-1-oxaspiro[4.5]deca-3,9-diene
Modify Date: 2025-09-27 17:02:23
![2,6,6,10-tetramethyl-1-oxaspiro[4.5]deca-3,9-diene Structure](https://image.chemsrc.com/caspic/132/54344-61-5.png)
2,6,6,10-tetramethyl-1-oxaspiro[4.5]deca-3,9-diene structure
|
Common Name | 2,6,6,10-tetramethyl-1-oxaspiro[4.5]deca-3,9-diene | ||
|---|---|---|---|---|
| CAS Number | 54344-61-5 | Molecular Weight | 192.29700 | |
| Density | 0.96g/cm3 | Boiling Point | 254.3ºC at 760 mmHg | |
| Molecular Formula | C13H20O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.9ºC | |
| Name | 2,6,6,10-tetramethyl-1-oxaspiro[4.5]deca-3,9-diene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.96g/cm3 |
|---|---|
| Boiling Point | 254.3ºC at 760 mmHg |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.29700 |
| Flash Point | 103.9ºC |
| Exact Mass | 192.15100 |
| PSA | 9.23000 |
| LogP | 3.46640 |
| Index of Refraction | 1.506 |
| InChIKey | BXVWNVFSJFBMTG-UHFFFAOYSA-N |
| SMILES | CC1=CCCC(C)(C)C12C=CC(C)O2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 259-116-7 |
| 3,6,10,10-tetramethyl-4-oxaspiro[4.5]deca-1,6-diene |
| 1-Oxaspiro(4.5)deca-3,6-diene,2,6,10,10-tetramethyl |
| 2,6,10,10-tetramethyl-1-oxaspiro[4.5]deca-3,6-diene |