3-(2-methyl-1-piperidyl)propoxy-phenyl-methanethione
Modify Date: 2025-08-24 11:25:29
3-(2-methyl-1-piperidyl)propoxy-phenyl-methanethione structure
|
Common Name | 3-(2-methyl-1-piperidyl)propoxy-phenyl-methanethione | ||
|---|---|---|---|---|
| CAS Number | 5435-04-1 | Molecular Weight | 313.88600 | |
| Density | 1.059g/cm3 | Boiling Point | 382.9ºC at 760 mmHg | |
| Molecular Formula | C16H24ClNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.4ºC | |
| Name | O-[3-(2-methylpiperidin-1-yl)propyl] benzenecarbothioate,hydrochloride |
|---|
| Density | 1.059g/cm3 |
|---|---|
| Boiling Point | 382.9ºC at 760 mmHg |
| Molecular Formula | C16H24ClNOS |
| Molecular Weight | 313.88600 |
| Flash Point | 185.4ºC |
| Exact Mass | 313.12700 |
| PSA | 44.56000 |
| LogP | 4.38310 |
| Index of Refraction | 1.554 |
| InChIKey | GKQYENPIIUQGPC-UHFFFAOYSA-N |
| SMILES | CC1CCCCN1CCCOC(=S)c1ccccc1.Cl |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |