N,N-dibutyl-2-chloro-benzenecarboximidamide structure
|
Common Name | N,N-dibutyl-2-chloro-benzenecarboximidamide | ||
|---|---|---|---|---|
| CAS Number | 5435-85-8 | Molecular Weight | 266.81000 | |
| Density | 1.02g/cm3 | Boiling Point | 341.6ºC at 760 mmHg | |
| Molecular Formula | C15H23ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.4ºC | |
| Name | N,N-dibutyl-2-chlorobenzenecarboximidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 341.6ºC at 760 mmHg |
| Molecular Formula | C15H23ClN2 |
| Molecular Weight | 266.81000 |
| Flash Point | 160.4ºC |
| Exact Mass | 266.15500 |
| PSA | 27.09000 |
| LogP | 4.66730 |
| Index of Refraction | 1.519 |
| InChIKey | QOACAZJRHYDELZ-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)C(=N)c1ccccc1Cl |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| n,n-dibutyl-2-chloro-benzenecarboximidamide |