tert-butyl 2-benzoylbenzoate structure
|
Common Name | tert-butyl 2-benzoylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 54354-02-8 | Molecular Weight | 282.33400 | |
| Density | 1.107g/cm3 | Boiling Point | 382.6ºC at 760 mmHg | |
| Molecular Formula | C18H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.3ºC | |
| Name | tert-butyl 2-benzoylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.107g/cm3 |
|---|---|
| Boiling Point | 382.6ºC at 760 mmHg |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.33400 |
| Flash Point | 166.3ºC |
| Exact Mass | 282.12600 |
| PSA | 43.37000 |
| LogP | 3.87290 |
| Index of Refraction | 1.553 |
| InChIKey | BNGCYQKRGJSWIY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1ccccc1C(=O)c1ccccc1 |
| HS Code | 2918300090 |
|---|
|
~91%
tert-butyl 2-be... CAS#:54354-02-8 |
| Literature: Clososki, Giuliano C.; Rohbogner, Christoph J.; Knochel, Paul Angewandte Chemie - International Edition, 2007 , vol. 46, # 40 p. 7681 - 7684 |
|
~%
tert-butyl 2-be... CAS#:54354-02-8 |
| Literature: Johnson et al. Journal of the American Chemical Society, 1950 , vol. 72, p. 514,516 |
|
~%
tert-butyl 2-be... CAS#:54354-02-8 |
| Literature: Johnson et al. Journal of the American Chemical Society, 1950 , vol. 72, p. 514,516 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-benzoyl-benzoic acid tert-butyl ester |
| 2-Benzoyl-benzoesaeure-tert-butylester |
| tert.-Butyl-2-benzoylbenzoat |
| tert-Butyl-o-benzoylbenzoat |