Benzenemethanol,2-methoxy-a,a-bis(4-methoxyphenyl)- structure
|
Common Name | Benzenemethanol,2-methoxy-a,a-bis(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 5436-09-9 | Molecular Weight | 350.40800 | |
| Density | 1.159g/cm3 | Boiling Point | 526.8ºC at 760mmHg | |
| Molecular Formula | C22H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.4ºC | |
| Name | (2-methoxyphenyl)-bis(4-methoxyphenyl)methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 526.8ºC at 760mmHg |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.40800 |
| Flash Point | 272.4ºC |
| Exact Mass | 350.15200 |
| PSA | 47.92000 |
| LogP | 3.99660 |
| Index of Refraction | 1.583 |
| InChIKey | TTXGDBLXRHYDJN-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(O)(c2ccc(OC)cc2)c2ccccc2OC)cc1 |
| HS Code | 2909499000 |
|---|
|
~%
Benzenemethanol... CAS#:5436-09-9 |
| Literature: Gomberg; Snow Journal of the American Chemical Society, 1925 , vol. 47, p. 209 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2.4'.4''-Trimethoxy-triphenylcarbinol |