2-(anilinocarbamoylmethylsulfanyl)-N-phenyl-acetohydrazide structure
|
Common Name | 2-(anilinocarbamoylmethylsulfanyl)-N-phenyl-acetohydrazide | ||
|---|---|---|---|---|
| CAS Number | 5436-11-3 | Molecular Weight | 330.40500 | |
| Density | 1.331g/cm3 | Boiling Point | 448.6ºC at 760 mmHg | |
| Molecular Formula | C16H18N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.1ºC | |
| Name | Thiodiglykolsaeure-bis-methylanilid |
|---|
| Density | 1.331g/cm3 |
|---|---|
| Boiling Point | 448.6ºC at 760 mmHg |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.40500 |
| Flash Point | 225.1ºC |
| Exact Mass | 330.11500 |
| PSA | 107.56000 |
| LogP | 2.93400 |
| Index of Refraction | 1.684 |
| InChIKey | YUDZIRYLUALRQZ-UHFFFAOYSA-N |
| SMILES | O=C(CSCC(=O)NNc1ccccc1)NNc1ccccc1 |
|
~%
2-(anilinocarba... CAS#:5436-11-3 |
| Literature: Zimmer; Shaheen Journal of Organic Chemistry, 1959 , vol. 24, p. 1140 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |