2-[(4-chlorophenyl)hydrazinylidene]propanoic acid structure
|
Common Name | 2-[(4-chlorophenyl)hydrazinylidene]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 5436-18-0 | Molecular Weight | 212.63300 | |
| Density | 1.31g/cm3 | Boiling Point | 356ºC at 760 mmHg | |
| Molecular Formula | C9H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.1ºC | |
| Name | 2-[(4-chlorophenyl)hydrazinylidene]propanoic acid |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 356ºC at 760 mmHg |
| Molecular Formula | C9H9ClN2O2 |
| Molecular Weight | 212.63300 |
| Flash Point | 169.1ºC |
| Exact Mass | 212.03500 |
| PSA | 61.69000 |
| LogP | 2.28540 |
| Index of Refraction | 1.579 |
| InChIKey | BFRDBVHWNKDMOG-IZZDOVSWSA-N |
| SMILES | CC(=NNc1ccc(Cl)cc1)C(=O)O |
|
~%
2-[(4-chlorophe... CAS#:5436-18-0 |
| Literature: Hewitt Journal of the Chemical Society, 1893 , vol. 63, p. 871 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |