1-chloro-1,1,2,2-tetrafluoro-2-(trifluoromethylperoxy)ethane structure
|
Common Name | 1-chloro-1,1,2,2-tetrafluoro-2-(trifluoromethylperoxy)ethane | ||
|---|---|---|---|---|
| CAS Number | 54362-31-1 | Molecular Weight | 236.47300 | |
| Density | 1.683g/cm3 | Boiling Point | 35.4ºC at 760 mmHg | |
| Molecular Formula | C3ClF7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-1,1,2,2-tetrafluoro-2-(trifluoromethylperoxy)ethane |
|---|
| Density | 1.683g/cm3 |
|---|---|
| Boiling Point | 35.4ºC at 760 mmHg |
| Molecular Formula | C3ClF7O2 |
| Molecular Weight | 236.47300 |
| Exact Mass | 235.94800 |
| PSA | 18.46000 |
| LogP | 2.87880 |
| Index of Refraction | 1.288 |
| InChIKey | HYFZHKNSODUQIF-UHFFFAOYSA-N |
| SMILES | FC(F)(F)OOC(F)(F)C(F)(F)Cl |
|
~%
1-chloro-1,1,2,... CAS#:54362-31-1 |
| Literature: Walker,N.; DesMarteau,D.D. Journal of the American Chemical Society, 1975 , vol. 97, # 1 p. 13 - 17 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |