Peroxide,2,2-dichloro-1,1,2-trifluoroethyl trifluoromethyl (9CI) structure
|
Common Name | Peroxide,2,2-dichloro-1,1,2-trifluoroethyl trifluoromethyl (9CI) | ||
|---|---|---|---|---|
| CAS Number | 54362-32-2 | Molecular Weight | 252.92700 | |
| Density | 1.727g/cm3 | Boiling Point | 70.9ºC at 760 mmHg | |
| Molecular Formula | C3Cl2F6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1-dichloro-1,2,2-trifluoro-2-(trifluoromethylperoxy)ethane |
|---|
| Density | 1.727g/cm3 |
|---|---|
| Boiling Point | 70.9ºC at 760 mmHg |
| Molecular Formula | C3Cl2F6O2 |
| Molecular Weight | 252.92700 |
| Exact Mass | 251.91800 |
| PSA | 18.46000 |
| LogP | 3.14810 |
| Index of Refraction | 1.331 |
| InChIKey | ZUSNQJZNPQLTFP-UHFFFAOYSA-N |
| SMILES | FC(F)(F)OOC(F)(F)C(F)(Cl)Cl |
|
~%
Peroxide,2,2-di... CAS#:54362-32-2 |
| Literature: Walker,N.; DesMarteau,D.D. Journal of the American Chemical Society, 1975 , vol. 97, # 1 p. 13 - 17 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |