3-(3-chloro-4-hydroxy-5-methoxy-phenyl)prop-2-enoic acid structure
|
Common Name | 3-(3-chloro-4-hydroxy-5-methoxy-phenyl)prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 5438-40-4 | Molecular Weight | 228.62900 | |
| Density | 1.434g/cm3 | Boiling Point | 386.4ºC at 760 mmHg | |
| Molecular Formula | C10H9ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.5ºC | |
| Name | (Z)-3-(3-chloro-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.434g/cm3 |
|---|---|
| Boiling Point | 386.4ºC at 760 mmHg |
| Molecular Formula | C10H9ClO4 |
| Molecular Weight | 228.62900 |
| Flash Point | 187.5ºC |
| Exact Mass | 228.01900 |
| PSA | 66.76000 |
| LogP | 2.15200 |
| Index of Refraction | 1.636 |
| InChIKey | JPBRRRVTXWVBIF-NSCUHMNNSA-N |
| SMILES | COc1cc(C=CC(=O)O)cc(Cl)c1O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-chloro-4-hydroxy-2-nitro-3-anisaldehyde |
| 5-Chlor-4-hydroxy-3-methoxy-trans-zimtsaeure |
| 5-Chlor-2-nitro-vanillin |
| 5-chloro-4-hydroxy-3-methoxy-trans-cinnamic acid |
| benzaldehyde,5-chloro-4-hydroxy-3-methoxy-2-nitro |
| 5-chloro-4-hydroxy-3-methoxy-2-nitro-benzaldehyde |
| 5-Chlor-4-hydroxy-3-methoxy-2-nitro-benzaldehyd |
| 2-Chloro-4-formyl-5-nitro-6-methoxyphenol |