Benzoicacid, 3,4-dihydroxy-, 2,3-dichloropropyl ester structure
|
Common Name | Benzoicacid, 3,4-dihydroxy-, 2,3-dichloropropyl ester | ||
|---|---|---|---|---|
| CAS Number | 5438-43-7 | Molecular Weight | 265.09000 | |
| Density | 1.469g/cm3 | Boiling Point | 470.5ºC at 760mmHg | |
| Molecular Formula | C10H10Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.4ºC | |
| Name | 2,3-dichloropropyl 3,4-dihydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.469g/cm3 |
|---|---|
| Boiling Point | 470.5ºC at 760mmHg |
| Molecular Formula | C10H10Cl2O4 |
| Molecular Weight | 265.09000 |
| Flash Point | 238.4ºC |
| Exact Mass | 263.99600 |
| PSA | 66.76000 |
| LogP | 2.10080 |
| Index of Refraction | 1.588 |
| InChIKey | XCQITELFZQNIME-UHFFFAOYSA-N |
| SMILES | O=C(OCC(Cl)CCl)c1ccc(O)c(O)c1 |
|
~%
Benzoicacid, 3,... CAS#:5438-43-7 |
| Literature: Pearl; Beyer Journal of the American Chemical Society, 1950 , vol. 72, p. 1743,1746 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Benzoicacid,3,4-dihydroxy-,2,3-dichloropropyl ester |