2-ethylbutyl 3,4-dihydroxybenzoate structure
|
Common Name | 2-ethylbutyl 3,4-dihydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 5438-57-3 | Molecular Weight | 238.28000 | |
| Density | 1.15g/cm3 | Boiling Point | 392.4ºC at 760 mmHg | |
| Molecular Formula | C13H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.4ºC | |
| Name | 2-ethylbutyl 3,4-dihydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 392.4ºC at 760 mmHg |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28000 |
| Flash Point | 146.4ºC |
| Exact Mass | 238.12100 |
| PSA | 66.76000 |
| LogP | 2.69080 |
| Index of Refraction | 1.539 |
| InChIKey | CCCKHDBAXCHRQZ-UHFFFAOYSA-N |
| SMILES | CCC(CC)COC(=O)c1ccc(O)c(O)c1 |
|
~%
2-ethylbutyl 3,... CAS#:5438-57-3 |
| Literature: Pearl; Beyer Journal of the American Chemical Society, 1950 , vol. 72, p. 1743,1746 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,4-dihydroxy-benzoic acid-(2-ethyl-butyl ester) |
| A8699 |
| 3,4-Dihydroxy-benzoesaeure-(2-aethyl-butylester) |