octyl 4-hydroxy-3-methoxy-benzoate structure
|
Common Name | octyl 4-hydroxy-3-methoxy-benzoate | ||
|---|---|---|---|---|
| CAS Number | 5438-62-0 | Molecular Weight | 280.35900 | |
| Density | 1.056g/cm3 | Boiling Point | 398.6ºC at 760 mmHg | |
| Molecular Formula | C16H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.5ºC | |
| Name | octyl 4-hydroxy-3-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.056g/cm3 |
|---|---|
| Boiling Point | 398.6ºC at 760 mmHg |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.35900 |
| Flash Point | 138.5ºC |
| Exact Mass | 280.16700 |
| PSA | 55.76000 |
| LogP | 3.91810 |
| Index of Refraction | 1.507 |
| InChIKey | CITHDNJMIRGMHS-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)c1ccc(O)c(OC)c1 |
| HS Code | 2918990090 |
|---|
|
~%
octyl 4-hydroxy... CAS#:5438-62-0 |
| Literature: Kubo, Isao; Xiao, Ping; Fujita, Ken'ichi Bioorganic and Medicinal Chemistry Letters, 2001 , vol. 11, # 3 p. 347 - 350 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| OCTYL 4-HYDROXY-3-METHOXY-BENZOATE |
| 4-Hydroxy-3-methoxy-benzoesaeure-octylester |
| 4-hydroxy-3-methoxy-benzoic acid octyl ester |