4-[(2-Nitrophenyl)amino]-phenol structure
|
Common Name | 4-[(2-Nitrophenyl)amino]-phenol | ||
|---|---|---|---|---|
| CAS Number | 54381-08-7 | Molecular Weight | 230.21900 | |
| Density | 1.388 g/cm3 | Boiling Point | 384.9ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O3 | Melting Point | 143-145ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | HC Orange 1 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.388 g/cm3 |
|---|---|
| Boiling Point | 384.9ºC at 760 mmHg |
| Melting Point | 143-145ºC |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.21900 |
| Exact Mass | 230.06900 |
| PSA | 78.08000 |
| LogP | 3.64020 |
| Index of Refraction | 1.699 |
| InChIKey | HSDSBIUUVWRHTM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1Nc1ccc(O)cc1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| hcorange1 |
| 4'-hydroxy-2-nitrodiphenylamine |
| MFCD00239470 |
| N-o-Nitrophenyl-1,4-aminophenol |
| EINECS 259-132-4 |
| iacute |
| HC ORANGE NO 1 |
| 2-nitro-4'-hydroxydiphenylamine |