16-phenoxy tetranor Prostaglandin E2 structure
|
Common Name | 16-phenoxy tetranor Prostaglandin E2 | ||
|---|---|---|---|---|
| CAS Number | 54382-74-0 | Molecular Weight | 388.454 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 605.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C22H28O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.5±25.0 °C | |
Use of 16-phenoxy tetranor Prostaglandin E216-phenoxy tetranor PGE2 is the free acid form of sulprostone formed by the hydrolysis of the methylsulfonamide bond. |
| Name | 16-phenoxy tetranor Prostaglandin E2 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 605.1±55.0 °C at 760 mmHg |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.454 |
| Flash Point | 208.5±25.0 °C |
| Exact Mass | 388.188599 |
| PSA | 104.06000 |
| LogP | 1.22 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | LYXKJZCRLQWIIN-OMIHVFMZSA-N |
| SMILES | O=C(O)CCCC=CCC1C(=O)CC(O)C1C=CC(O)COc1ccccc1 |
| (5Z)-7-{(2R,3R)-3-Hydroxy-2-[(1E,3R)-3-hydroxy-4-phenoxy-1-buten-1-yl]-5-oxocyclopentyl}-5-heptenoic acid |
| 5-Heptenoic acid, 7-[(2R,3R)-3-hydroxy-2-[(1E,3R)-3-hydroxy-4-phenoxy-1-buten-1-yl]-5-oxocyclopentyl]-, (5Z)- |