Butanamide, N-[1,1'-biphenyl]-2-yl-3-methyl- structure
|
Common Name | Butanamide, N-[1,1'-biphenyl]-2-yl-3-methyl- | ||
|---|---|---|---|---|
| CAS Number | 5439-23-6 | Molecular Weight | 253.33900 | |
| Density | 1.065g/cm3 | Boiling Point | 406.5ºC at 760mmHg | |
| Molecular Formula | C17H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.8ºC | |
| Name | 3-methyl-N-(2-phenylphenyl)butanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.065g/cm3 |
|---|---|
| Boiling Point | 406.5ºC at 760mmHg |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.33900 |
| Flash Point | 247.8ºC |
| Exact Mass | 253.14700 |
| PSA | 29.10000 |
| LogP | 4.41120 |
| Index of Refraction | 1.578 |
| InChIKey | AGVHQHNPCTYIDJ-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)Nc1ccccc1-c1ccccc1 |
|
~%
Butanamide, N-[... CAS#:5439-23-6 |
| Literature: Buu-Hoi et al. Journal of the Chemical Society, 1957 , p. 505,507 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-biphenyl-2-yl-isovaleramide |
| n-(biphenyl-2-yl)-3-methylbutanamide |