3-(3,6-ditert-butylcarbazol-9-yl)propanoic acid
Modify Date: 2025-08-25 17:49:28
3-(3,6-ditert-butylcarbazol-9-yl)propanoic acid structure
|
Common Name | 3-(3,6-ditert-butylcarbazol-9-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 5439-28-1 | Molecular Weight | 351.48200 | |
| Density | 1.07g/cm3 | Boiling Point | 477.3ºC at 760 mmHg | |
| Molecular Formula | C23H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.4ºC | |
| Name | 3-(3,6-ditert-butylcarbazol-9-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 477.3ºC at 760 mmHg |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.48200 |
| Flash Point | 242.4ºC |
| Exact Mass | 351.22000 |
| PSA | 42.23000 |
| LogP | 5.86420 |
| Index of Refraction | 1.562 |
| InChIKey | MFVSFXSONJGHBA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2CCC(=O)O |
| HS Code | 2933990090 |
|---|
|
~%
3-(3,6-ditert-b... CAS#:5439-28-1 |
| Literature: Smith Journal of the American Chemical Society, 1950 , vol. 72, p. 4313 |
|
~%
3-(3,6-ditert-b... CAS#:5439-28-1 |
| Literature: Smith Journal of the American Chemical Society, 1950 , vol. 72, p. 4313 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(3,6-di-tert-butyl-carbazol-9-yl)-propionic acid |
| 3-(3,6-di-tert-butyl-9h-carbazol-9-yl)propanoic acid |
| 3-(3,6-Di-tert-butyl-carbazol-9-yl)-propionsaeure |