ethyl 3-(dimethylaminomethyl)-1H-indole-2-carboxylate structure
|
Common Name | ethyl 3-(dimethylaminomethyl)-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5439-83-8 | Molecular Weight | 246.30500 | |
| Density | 1.157g/cm3 | Boiling Point | 393.8ºC at 760 mmHg | |
| Molecular Formula | C14H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192ºC | |
| Name | ethyl 3-[(dimethylamino)methyl]-1H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.157g/cm3 |
|---|---|
| Boiling Point | 393.8ºC at 760 mmHg |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.30500 |
| Flash Point | 192ºC |
| Exact Mass | 246.13700 |
| PSA | 45.33000 |
| LogP | 2.40620 |
| Index of Refraction | 1.6 |
| InChIKey | XCLWRWMGOGPGDS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]c2ccccc2c1CN(C)C |
| HS Code | 2933990090 |
|---|
|
~65%
ethyl 3-(dimeth... CAS#:5439-83-8 |
| Literature: Wadia, M. S.; Mali, R. S.; Tilve, S. G.; Yadav, V. J. Synthesis, 1987 , # 4 p. 401 - 404 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 3-(dimethylaminomethyl)-1H-indole-2-carboxylate |
| 3-dimethylaminomethyl-indole-2-carboxylic acid ethyl ester |
| Ethyl 3-dimethylaminomethylindole-2-carboxylate |
| 3-Dimethylaminomethyl-indol-2-carbonsaeure-aethylester |
| 1h-indole-2-carboxylic acid,3-[(dimethylamino)methyl]-,ethyl ester |