tert-butyl octahydro-4-hydroxyindole-1-carboxylate structure
|
Common Name | tert-butyl octahydro-4-hydroxyindole-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 543910-49-2 | Molecular Weight | 241.32700 | |
| Density | 1.117g/cm3 | Boiling Point | 345ºC at 760 mmHg | |
| Molecular Formula | C13H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.5ºC | |
| Name | tert-butyl 4-hydroxy-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.117g/cm3 |
|---|---|
| Boiling Point | 345ºC at 760 mmHg |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.32700 |
| Flash Point | 162.5ºC |
| Exact Mass | 241.16800 |
| PSA | 49.77000 |
| LogP | 2.09470 |
| Index of Refraction | 1.513 |
| InChIKey | MRMYRYLVMIZVQM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2C(O)CCCC21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-Butyl octahydro-4-hydroxyindole-1-carboxylate |
| tert-Butyl 4-hydroxyoctahydro-1H-indole-1-carboxylate |