Arsonic acid,[4-(aminocarbonyl)-3-nitrophenyl]- (9CI) structure
|
Common Name | Arsonic acid,[4-(aminocarbonyl)-3-nitrophenyl]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 5440-11-9 | Molecular Weight | 290.06200 | |
| Density | N/A | Boiling Point | 572.7ºC at 760mmHg | |
| Molecular Formula | C7H7AsN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.2ºC | |
| Name | (4-carbamoyl-3-nitro-phenyl)-arsonic acid |
|---|
| Boiling Point | 572.7ºC at 760mmHg |
|---|---|
| Molecular Formula | C7H7AsN2O6 |
| Molecular Weight | 290.06200 |
| Flash Point | 300.2ºC |
| Exact Mass | 289.95200 |
| PSA | 146.44000 |
| InChIKey | WUYILKNJYBJDDM-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc([As](=O)(O)O)cc1[N+](=O)[O-] |
|
~%
Arsonic acid,[4... CAS#:5440-11-9 |
| Literature: Doak; Steinman; Eagle Journal of the American Chemical Society, 1944 , vol. 66, p. 194,196 Journal of the American Chemical Society, 1945 , vol. 67, p. 719 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |