diethyl 2-acetamido-2-nonyl-propanedioate
Modify Date: 2025-08-26 11:06:45
diethyl 2-acetamido-2-nonyl-propanedioate structure
|
Common Name | diethyl 2-acetamido-2-nonyl-propanedioate | ||
|---|---|---|---|---|
| CAS Number | 5440-56-2 | Molecular Weight | 343.45800 | |
| Density | 1.014g/cm3 | Boiling Point | 439.6ºC at 760 mmHg | |
| Molecular Formula | C18H33NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.6ºC | |
| Name | diethyl (acetylamino)(nonyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.014g/cm3 |
|---|---|
| Boiling Point | 439.6ºC at 760 mmHg |
| Molecular Formula | C18H33NO5 |
| Molecular Weight | 343.45800 |
| Flash Point | 219.6ºC |
| Exact Mass | 343.23600 |
| PSA | 81.70000 |
| LogP | 3.51910 |
| Index of Refraction | 1.459 |
| InChIKey | NUJXESBVQGHSJH-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(NC(C)=O)(C(=O)OCC)C(=O)OCC |
| HS Code | 2924199090 |
|---|
|
~%
diethyl 2-aceta... CAS#:5440-56-2 |
| Literature: Albertson Journal of the American Chemical Society, 1946 , vol. 68, p. 452 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| acetylamino-nonyl-malonic acid diethyl ester |
| Acetamino-nonyl-malonsaeure-diaethylester |
| Acetylamino-nonyl-malonsaeure-diaethylester |
| diethyl 2-acetamido-2-nonylpropanedioate |