Propanedioicacid, 2-(acetylamino)-2-(1-naphthalenylmethyl)-, 1,3-diethyl ester structure
|
Common Name | Propanedioicacid, 2-(acetylamino)-2-(1-naphthalenylmethyl)-, 1,3-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 5440-57-3 | Molecular Weight | 357.40000 | |
| Density | 1.185g/cm3 | Boiling Point | 531.7ºC at 760mmHg | |
| Molecular Formula | C20H23NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.4ºC | |
| Name | diethyl 2-acetamido-2-(naphthalen-1-ylmethyl)propanedioate |
|---|
| Density | 1.185g/cm3 |
|---|---|
| Boiling Point | 531.7ºC at 760mmHg |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.40000 |
| Flash Point | 275.4ºC |
| Exact Mass | 357.15800 |
| PSA | 81.70000 |
| LogP | 2.77430 |
| Index of Refraction | 1.562 |
| InChIKey | LGRLDHYLVHVRRC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1cccc2ccccc12)(NC(C)=O)C(=O)OCC |
|
~76%
Propanedioicaci... CAS#:5440-57-3 |
| Literature: Adir et Compagnie Patent: US5712312 A1, 1998 ; US 5712312 A |
|
~89%
Propanedioicaci... CAS#:5440-57-3 |
| Literature: Rodriguez; Bernad; Galas; Lignon; Laur; Aumelas; Martinez European Journal of Medicinal Chemistry, 1991 , vol. 26, # 3 p. 245 - 253 |