8-chloro-1,7-dimethyl-3-prop-2-enyl-purine-2,6-dione structure
|
Common Name | 8-chloro-1,7-dimethyl-3-prop-2-enyl-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 5441-71-4 | Molecular Weight | 254.67300 | |
| Density | 1.45g/cm3 | Boiling Point | 442.2ºC at 760 mmHg | |
| Molecular Formula | C10H11ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.3ºC | |
| Name | 8-chloro-1,7-dimethyl-3-prop-2-enylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 442.2ºC at 760 mmHg |
| Molecular Formula | C10H11ClN4O2 |
| Molecular Weight | 254.67300 |
| Flash Point | 221.3ºC |
| Exact Mass | 254.05700 |
| PSA | 61.82000 |
| LogP | 0.27310 |
| Index of Refraction | 1.654 |
| InChIKey | XXMVFZJNPRTFLK-UHFFFAOYSA-N |
| SMILES | C=CCn1c(=O)n(C)c(=O)c2c1nc(Cl)n2C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Allyl-8-chlor-1,7-dimethyl-3,7-dihydro-purin-2,6-dion |
| 3-allyl-8-chloro-1,7-dimethyl-3,7-dihydro-purine-2,6-dione |