(1-dimethylamino-3-methoxy-propan-2-yl) 4-nitrobenzoate structure
|
Common Name | (1-dimethylamino-3-methoxy-propan-2-yl) 4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 5441-74-7 | Molecular Weight | 317.74500 | |
| Density | 1.197g/cm3 | Boiling Point | 392.2ºC at 760 mmHg | |
| Molecular Formula | C13H18ClN2O5- | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191ºC | |
| Name | [1-(dimethylamino)-3-methoxypropan-2-yl] 4-nitrobenzoate,chloride |
|---|
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 392.2ºC at 760 mmHg |
| Molecular Formula | C13H18ClN2O5- |
| Molecular Weight | 317.74500 |
| Flash Point | 191ºC |
| Exact Mass | 317.09000 |
| PSA | 84.59000 |
| Index of Refraction | 1.533 |
| InChIKey | CZKFSSFEOKXZCA-UHFFFAOYSA-M |
| SMILES | COCC(CN(C)C)OC(=O)c1ccc([N+](=O)[O-])cc1.[Cl-] |
|
~%
(1-dimethylamin... CAS#:5441-74-7 |
| Literature: Blicke; Biel Journal of the American Chemical Society, 1954 , vol. 76, p. 3163,3165 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |