2-ethoxy-N,N-dipropyl-benzamide structure
|
Common Name | 2-ethoxy-N,N-dipropyl-benzamide | ||
|---|---|---|---|---|
| CAS Number | 5442-04-6 | Molecular Weight | 249.34900 | |
| Density | 0.992g/cm3 | Boiling Point | 385.8ºC at 760 mmHg | |
| Molecular Formula | C15H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.2ºC | |
| Name | 2-ethoxy-N,N-dipropylbenzamide |
|---|
| Density | 0.992g/cm3 |
|---|---|
| Boiling Point | 385.8ºC at 760 mmHg |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.34900 |
| Flash Point | 187.2ºC |
| Exact Mass | 249.17300 |
| PSA | 29.54000 |
| LogP | 3.34750 |
| Index of Refraction | 1.504 |
| InChIKey | GEXWPSVMGWBGCI-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)C(=O)c1ccccc1OCC |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |