4-methoxy-2-nitro-N-phenyl-aniline
Modify Date: 2026-08-16 19:00:17
4-methoxy-2-nitro-N-phenyl-aniline structure
|
Common Name | 4-methoxy-2-nitro-N-phenyl-aniline | ||
|---|---|---|---|---|
| CAS Number | 5442-46-6 | Molecular Weight | 244.24600 | |
| Density | 1.276g/cm3 | Boiling Point | 397ºC at 760 mmHg | |
| Molecular Formula | C13H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.9ºC | |
| Name | 2-methyl-3-(4-prop-1-en-2-ylcyclohexen-1-yl)propanal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.276g/cm3 |
|---|---|
| Boiling Point | 397ºC at 760 mmHg |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.24600 |
| Flash Point | 193.9ºC |
| Exact Mass | 244.08500 |
| PSA | 67.08000 |
| LogP | 3.94320 |
| Index of Refraction | 1.639 |
| InChIKey | UJOUHSUSULMZDW-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2ccccc2)c([N+](=O)[O-])c1 |
| HS Code | 2922299090 |
|---|
|
~97%
4-methoxy-2-nit... CAS#:5442-46-6 |
| Literature: Tietze, Mario; Iglesias, Alberto; Merisor, Elena; Conrad, Juergen; Klaiber, Iris; Beifuss, Uwe Organic Letters, 2005 , vol. 7, # 8 p. 1549 - 1552 |
|
~%
4-methoxy-2-nit... CAS#:5442-46-6 |
| Literature: King; King; Muir Journal of the Chemical Society, 1946 , p. 5,8 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:4190-95-8| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Methoxy-2-nitrodiphenylamin |
| EINECS 258-592-3 |
| 4-methoxy-2-nitrodiphenylamine |