Benzoic acid,2-arsonoyl-4-nitro-, sodium salt (1:1) structure
|
Common Name | Benzoic acid,2-arsonoyl-4-nitro-, sodium salt (1:1) | ||
|---|---|---|---|---|
| CAS Number | 5442-72-8 | Molecular Weight | 314.03600 | |
| Density | N/A | Boiling Point | 660.9ºC at 760mmHg | |
| Molecular Formula | C7H6AsNNaO7+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.5ºC | |
| Name | sodium,2-arsono-4-nitrobenzoic acid |
|---|
| Boiling Point | 660.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C7H6AsNNaO7+ |
| Molecular Weight | 314.03600 |
| Flash Point | 287.5ºC |
| Exact Mass | 313.92600 |
| PSA | 140.65000 |
| InChIKey | AHCSQIIPSBLQIG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1[As](=O)(O)O.[Na+] |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |