Arsonic acid, [4-(acetylamino)-3-nitrophenyl]-(9CI) structure
|
Common Name | Arsonic acid, [4-(acetylamino)-3-nitrophenyl]-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 5442-74-0 | Molecular Weight | 304.08800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9AsN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-acetamido-3-nitrophenyl)arsonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H9AsN2O6 |
|---|---|
| Molecular Weight | 304.08800 |
| Exact Mass | 303.96800 |
| PSA | 132.45000 |
| InChIKey | VBTPMPMANQBFAK-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc([As](=O)(O)O)cc1[N+](=O)[O-] |
|
~%
Arsonic acid, [... CAS#:5442-74-0 |
| Literature: Phillips Journal of the Chemical Society, 1929 , p. 2828 |
| [4-(acetylamino)-3-nitrophenyl]arsonic acid |
| (4-Acetylamino-3-nitro-phenyl)-arsonsaeure |
| 3-Nitro-4-acetamino-phenylarsonsaeure |