[4-(carbamoylmethylcarbamoyl)phenyl]arsonic acid
Modify Date: 2025-08-26 07:29:53
![[4-(carbamoylmethylcarbamoyl)phenyl]arsonic acid Structure](https://image.chemsrc.com/caspic/172/5442-76-2.png)
[4-(carbamoylmethylcarbamoyl)phenyl]arsonic acid structure
|
Common Name | [4-(carbamoylmethylcarbamoyl)phenyl]arsonic acid | ||
|---|---|---|---|---|
| CAS Number | 5442-76-2 | Molecular Weight | 302.11600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11AsN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]arsonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11AsN2O5 |
|---|---|
| Molecular Weight | 302.11600 |
| Exact Mass | 301.98800 |
| PSA | 129.72000 |
| InChIKey | HNRUUBSGULOGOD-UHFFFAOYSA-N |
| SMILES | NC(=O)CNC(=O)c1ccc([As](=O)(O)O)cc1 |
| HS Code | 2931900090 |
|---|
|
~%
[4-(carbamoylme... CAS#:5442-76-2 |
| Literature: Cohen; King; Strangeways Journal of the Chemical Society, 1931 , p. 3236,3253 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| [4-(Carbamoylmethyl-carbamoyl)-phenyl]-arsonsaeure |
| [4-(carbamoylmethyl-carbamoyl)-phenyl]-arsonic acid |
| n2-(4-arsonobenzoyl)glycinamide |