Acetic acid,2-[(7-chloro-3-methyl-4-quinolinyl)thio]- structure
|
Common Name | Acetic acid,2-[(7-chloro-3-methyl-4-quinolinyl)thio]- | ||
|---|---|---|---|---|
| CAS Number | 5443-01-6 | Molecular Weight | 267.73100 | |
| Density | 1.44g/cm3 | Boiling Point | 459.1ºC at 760 mmHg | |
| Molecular Formula | C12H10ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.5ºC | |
| Name | 2-(7-chloro-3-methylquinolin-4-yl)sulfanylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 459.1ºC at 760 mmHg |
| Molecular Formula | C12H10ClNO2S |
| Molecular Weight | 267.73100 |
| Flash Point | 231.5ºC |
| Exact Mass | 267.01200 |
| PSA | 75.49000 |
| LogP | 3.37330 |
| Index of Refraction | 1.684 |
| InChIKey | PSLQZFKHPIRPMU-UHFFFAOYSA-N |
| SMILES | Cc1cnc2cc(Cl)ccc2c1SCC(=O)O |
|
~%
Acetic acid,2-[... CAS#:5443-01-6 |
| Literature: Surrey Journal of the American Chemical Society, 1948 , vol. 70, p. 2190,2191 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (7-Chlor-3-methyl-[4]chinolylmercapto)-essigsaeure |
| (7-chloro-3-methyl-[4]quinolylmercapto)-acetic acid |
| (7-Chlor-2-methyl-indol-3-yl)-essigsaeure |
| (7-chloro-2-methyl-indol-3-yl)-acetic acid |
| (7-chloro-2-methyl-1H-indol-3-yl)acetic acid |