4-Quinolineethanol,6-methoxy-a-(trichloromethyl)- structure
|
Common Name | 4-Quinolineethanol,6-methoxy-a-(trichloromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 5443-15-2 | Molecular Weight | 320.59900 | |
| Density | 1.442g/cm3 | Boiling Point | 458.7ºC at 760mmHg | |
| Molecular Formula | C13H12Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.2ºC | |
| Name | 1,1,1-trichloro-3-(6-methoxyquinolin-4-yl)propan-2-ol |
|---|
| Density | 1.442g/cm3 |
|---|---|
| Boiling Point | 458.7ºC at 760mmHg |
| Molecular Formula | C13H12Cl3NO2 |
| Molecular Weight | 320.59900 |
| Flash Point | 231.2ºC |
| Exact Mass | 318.99300 |
| PSA | 42.35000 |
| LogP | 3.51700 |
| Index of Refraction | 1.63 |
| InChIKey | ZCRUVFSJUVJMSI-UHFFFAOYSA-N |
| SMILES | COc1ccc2nccc(CC(O)C(Cl)(Cl)Cl)c2c1 |
| HS Code | 2933499090 |
|---|
|
~%
4-Quinolineetha... CAS#:5443-15-2 |
| Literature: Cornforth; Cornforth Journal of the Chemical Society, 1948 , p. 93,96 |
|
~%
4-Quinolineetha... CAS#:5443-15-2 |
| Literature: Walker Journal of the Chemical Society, 1947 , p. 1684,1687 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |