5-Pyrimidinemethanol, a-[2-(diethylamino)ethyl]-4-methyl-2-phenyl-
Modify Date: 2025-09-13 11:36:03
![5-Pyrimidinemethanol, a-[2-(diethylamino)ethyl]-4-methyl-2-phenyl- Structure](https://image.chemsrc.com/caspic/002/5443-18-5.png)
5-Pyrimidinemethanol, a-[2-(diethylamino)ethyl]-4-methyl-2-phenyl- structure
|
Common Name | 5-Pyrimidinemethanol, a-[2-(diethylamino)ethyl]-4-methyl-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 5443-18-5 | Molecular Weight | 299.41100 | |
| Density | 1.075g/cm3 | Boiling Point | 395.4ºC at 760mmHg | |
| Molecular Formula | C18H25N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.9ºC | |
| Name | 3-(diethylamino)-1-(4-methyl-2-phenylpyrimidin-5-yl)propan-1-ol |
|---|
| Density | 1.075g/cm3 |
|---|---|
| Boiling Point | 395.4ºC at 760mmHg |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.41100 |
| Flash Point | 192.9ºC |
| Exact Mass | 299.20000 |
| PSA | 49.25000 |
| LogP | 3.21730 |
| Index of Refraction | 1.558 |
| InChIKey | VWUJAYNGIKLTBV-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCC(O)c1cnc(-c2ccccc2)nc1C |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |