N,N-dibenzyl-2,3-dichloro-3-phenyl-propan-1-amine structure
|
Common Name | N,N-dibenzyl-2,3-dichloro-3-phenyl-propan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 5443-67-4 | Molecular Weight | 420.80200 | |
| Density | 1.185g/cm3 | Boiling Point | 461.5ºC at 760 mmHg | |
| Molecular Formula | C23H24Cl3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.9ºC | |
| Name | N,N-dibenzyl-2,3-dichloro-3-phenylpropan-1-amine,hydrochloride |
|---|
| Density | 1.185g/cm3 |
|---|---|
| Boiling Point | 461.5ºC at 760 mmHg |
| Molecular Formula | C23H24Cl3N |
| Molecular Weight | 420.80200 |
| Flash Point | 232.9ºC |
| Exact Mass | 419.09700 |
| PSA | 3.24000 |
| LogP | 7.07830 |
| Index of Refraction | 1.607 |
| InChIKey | VTXRBYJSACGFDT-UHFFFAOYSA-N |
| SMILES | Cl.ClC(CN(Cc1ccccc1)Cc1ccccc1)C(Cl)c1ccccc1 |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |