3-phenyl-1-prop-2-enylpyrrolidine-2,5-dione structure
|
Common Name | 3-phenyl-1-prop-2-enylpyrrolidine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 54433-51-1 | Molecular Weight | 215.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-phenyl-1-prop-2-enylpyrrolidine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H13NO2 |
|---|---|
| Molecular Weight | 215.24800 |
| Exact Mass | 215.09500 |
| PSA | 37.38000 |
| LogP | 1.65300 |
| InChIKey | IERQGYJHMURHJP-UHFFFAOYSA-N |
| SMILES | C=CCN1C(=O)CC(c2ccccc2)C1=O |
|
~%
3-phenyl-1-prop... CAS#:54433-51-1 |
| Literature: Miller; Long Journal of the American Chemical Society, 1951 , vol. 73, p. 4895,4897 |
|
~%
3-phenyl-1-prop... CAS#:54433-51-1 |
| Literature: Parke,Davis and Co. Patent: US2643258 , 1950 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-Allyl-3-phenyl-pyrrolidin-2,5-dion |
| 1-allyl-3-phenyl-pyrrolidine-2,5-dione |
| 2,5-Pyrrolidinedione,3-phenyl-1-(2-propenyl) |