6-(3-methylphenyl)sulfanyl-5H-purine structure
|
Common Name | 6-(3-methylphenyl)sulfanyl-5H-purine | ||
|---|---|---|---|---|
| CAS Number | 5444-09-7 | Molecular Weight | 242.30000 | |
| Density | 1.4g/cm3 | Boiling Point | 402ºC at 760 mmHg | |
| Molecular Formula | C12H10N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.9ºC | |
| Name | 6-(3-methylphenyl)sulfanyl-7H-purine |
|---|
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 402ºC at 760 mmHg |
| Molecular Formula | C12H10N4S |
| Molecular Weight | 242.30000 |
| Flash Point | 196.9ºC |
| Exact Mass | 242.06300 |
| PSA | 79.76000 |
| LogP | 2.81250 |
| Index of Refraction | 1.745 |
| InChIKey | ADDYYCKFGJCXGZ-UHFFFAOYSA-N |
| SMILES | Cc1cccc(Sc2ncnc3nc[nH]c23)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |