[3-(1-piperidylmethyl)phenyl] acetate structure
|
Common Name | [3-(1-piperidylmethyl)phenyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 5444-11-1 | Molecular Weight | 269.76700 | |
| Density | 1.093g/cm3 | Boiling Point | 305.4ºC at 760 mmHg | |
| Molecular Formula | C14H20ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 105.6ºC | |
| Name | [3-(piperidin-1-ylmethyl)phenyl] acetate,hydrochloride |
|---|
| Density | 1.093g/cm3 |
|---|---|
| Boiling Point | 305.4ºC at 760 mmHg |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.76700 |
| Flash Point | 105.6ºC |
| Exact Mass | 269.11800 |
| PSA | 29.54000 |
| LogP | 3.33770 |
| Index of Refraction | 1.541 |
| InChIKey | NSLDCYPGNUBPGG-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1cccc(CN2CCCCC2)c1.Cl |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |