N,N-dimethyl-N-(7H-purin-6-yl)propane-1,3-diamine structure
|
Common Name | N,N-dimethyl-N-(7H-purin-6-yl)propane-1,3-diamine | ||
|---|---|---|---|---|
| CAS Number | 5444-38-2 | Molecular Weight | 220.27400 | |
| Density | 1.3g/cm3 | Boiling Point | 335.3ºC at 760 mmHg | |
| Molecular Formula | C10H16N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.6ºC | |
| Name | N',N'-dimethyl-N-(7H-purin-6-yl)propane-1,3-diamine |
|---|
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 335.3ºC at 760 mmHg |
| Molecular Formula | C10H16N6 |
| Molecular Weight | 220.27400 |
| Flash Point | 156.6ºC |
| Exact Mass | 220.14400 |
| PSA | 69.73000 |
| LogP | 0.78950 |
| Index of Refraction | 1.658 |
| InChIKey | XPGRGGGJIBQROV-UHFFFAOYSA-N |
| SMILES | CN(C)CCCNc1ncnc2nc[nH]c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |